C15H24S2 — CID 134938118
2-methyl-2-[(E)-2-(2,6,6-trimethylcyclohex-2-en-1-yl)ethenyl]-1,3-dithiolane (PubChem CID 134938118) has the molecular formula C15H24S2 and a molecular weight of 268.49 g/mol. Its IUPAC name is 2-methyl-2-[(E)-2-(2,6,6-trimethylcyclohex-2-en-1-yl)ethenyl]-1,3-dithiolane.
| Compound Name | 2-methyl-2-[(E)-2-(2,6,6-trimethylcyclohex-2-en-1-yl)ethenyl]-1,3-dithiolane |
|---|---|
| PubChem CID | 134938118 |
| Molecular Formula | C15H24S2 |
| Molecular Weight | 268.49 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 2-methyl-2-[(E)-2-(2,6,6-trimethylcyclohex-2-en-1-yl)ethenyl]-1,3-dithiolane |
| SMILES | CC1=CCCC(C)(C)C1/C=C/C1(C)SCCS1 |
| InChI | InChI=1S/C15H24S2/c1-12-6-5-8-14(2,3)13(12)7-9-15(4)16-10-11-17-15/h6-7,9,13H,5,8,10-11H2,1-4H3/b9-7+ |
| InChIKey | CUYHBWLRXFSPSN-VQHVLOKHSA-N |
| XLogP | 5.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.49 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|