C40H76O4Si2 — CID 134938179
[3-methoxy-5,6,8-trimethyl-8-[(4R,8S,12S)-4,8,12,13-tetramethyltetradecyl]-2-trimethylsilyl-1,2,4a,9,10,10b-hexahydropyrano[3,2-f]chromen-3-yl]oxy-trimethylsilane (PubChem CID 134938179) has the molecular formula C40H76O4Si2 and a molecular weight of 677.22 g/mol. Its IUPAC name is [3-methoxy-5,6,8-trimethyl-8-[(4R,8S,12S)-4,8,12,13-tetramethyltetradecyl]-2-trimethylsilyl-1,2,4a,9,10,10b-hexahydropyrano[3,2-f]chromen-3-yl]oxy-trimethylsilane.
| Compound Name | [3-methoxy-5,6,8-trimethyl-8-[(4R,8S,12S)-4,8,12,13-tetramethyltetradecyl]-2-trimethylsilyl-1,2,4a,9,10,10b-hexahydropyrano[3,2-f]chromen-3-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 134938179 |
| Molecular Formula | C40H76O4Si2 |
| Molecular Weight | 677.22 g/mol |
| Exact Mass | 676.53 |
| IUPAC Name | [3-methoxy-5,6,8-trimethyl-8-[(4R,8S,12S)-4,8,12,13-tetramethyltetradecyl]-2-trimethylsilyl-1,2,4a,9,10,10b-hexahydropyrano[3,2-f]chromen-3-yl]oxy-trimethylsilane |
| SMILES | COC1(O[Si](C)(C)C)OC2C(C)=C(C)C3=C(CCC(C)(CCC[C@H](C)CCC[C@H](C)CCC[C@H](C)C(C)C)O3)C2CC1[Si](C)(C)C |
| InChI | InChI=1S/C40H76O4Si2/c1-28(2)31(5)23-17-21-29(3)19-16-20-30(4)22-18-25-39(8)26-24-34-35-27-36(45(10,11)12)40(41-9,44-46(13,14)15)43-38(35)33(7)32(6)37(34)42-39/h28-31,35-36,38H,16-27H2,1-15H3/t29-,30+,31-,35?,36?,38?,39?,40?/m0/s1 |
| InChIKey | MHZKCZXZEYIIOS-XIIIGQKXSA-N |
| XLogP | 12.50 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.22 |
| LogP ≤ 5 | 12.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|