C16H22O10S — CID 134938307
[(2S,3R,4S,5R,6R)-4,5,6-triacetyloxy-2-(acetylsulfanylmethyl)oxan-3-yl] acetate (PubChem CID 134938307) has the molecular formula C16H22O10S and a molecular weight of 406.41 g/mol. Its IUPAC name is [(2S,3R,4S,5R,6R)-4,5,6-triacetyloxy-2-(acetylsulfanylmethyl)oxan-3-yl] acetate.
| Compound Name | [(2S,3R,4S,5R,6R)-4,5,6-triacetyloxy-2-(acetylsulfanylmethyl)oxan-3-yl] acetate |
|---|---|
| PubChem CID | 134938307 |
| Molecular Formula | C16H22O10S |
| Molecular Weight | 406.41 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | [(2S,3R,4S,5R,6R)-4,5,6-triacetyloxy-2-(acetylsulfanylmethyl)oxan-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1O[C@H](CSC(C)=O)[C@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C16H22O10S/c1-7(17)22-13-12(6-27-11(5)21)26-16(25-10(4)20)15(24-9(3)19)14(13)23-8(2)18/h12-16H,6H2,1-5H3/t12-,13+,14+,15-,16+/m1/s1 |
| InChIKey | BTEKCGJCPLXBRE-CWVYHPPDSA-N |
| XLogP | 0.35 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.41 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|