About lithium;potassium;7H-indole-1,7-diide
lithium;potassium;7H-indole-1,7-diide (PubChem CID 134938460) has the molecular formula C8H5KLiN
and a molecular weight of 161.17 g/mol. Its IUPAC name is lithium;potassium;7H-indole-1,7-diide.
Molecular Properties
| Compound Name | lithium;potassium;7H-indole-1,7-diide |
| PubChem CID | 134938460 |
| Molecular Formula | C8H5KLiN |
| Molecular Weight | 161.17 g/mol |
| Exact Mass | 161.02 |
| IUPAC Name | lithium;potassium;7H-indole-1,7-diide |
| SMILES | [K+].[Li+].[c-]1cccc2cc[n-]c12 |
| InChI | InChI=1S/C8H5N.K.Li/c1-2-4-8-7(3-1)5-6-9-8;;/h1-3,5-6H;;/q-2;2*+1 |
| InChIKey | UAXIXWYXBGYEBV-UHFFFAOYSA-N |
| XLogP | -4.39 |
| TPSA | 14.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.17 |
| LogP ≤ 5 | -4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze lithium;potassium;7H-indole-1,7-diide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;potassium;7H-indole-1,7-diide?
The IUPAC name of lithium;potassium;7H-indole-1,7-diide (CID 134938460) is lithium;potassium;7H-indole-1,7-diide.
What is the SMILES notation for lithium;potassium;7H-indole-1,7-diide?
The canonical SMILES for lithium;potassium;7H-indole-1,7-diide is [K+].[Li+].[c-]1cccc2cc[n-]c12.
What is the InChIKey of lithium;potassium;7H-indole-1,7-diide?
The InChIKey is UAXIXWYXBGYEBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5N.K.Li/c1-2-4-8-7(3-1)5-6-9-8;;/h1-3,5-6H;;/q-2;2*+1.
What are the key properties of lithium;potassium;7H-indole-1,7-diide?
lithium;potassium;7H-indole-1,7-diide has a molecular weight of 161.17 g/mol, XLogP of -4.39, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;potassium;7H-indole-1,7-diide is sourced from PubChem (CID 134938460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).