C17H33BO3Si — CID 134938742
tert-butyl-[(E,3S)-2-[(6S)-2-hydroxy-5,6-dihydrooxaborinin-6-yl]-2-methylhex-4-en-3-yl]oxy-dimethylsilane (PubChem CID 134938742) has the molecular formula C17H33BO3Si and a molecular weight of 324.35 g/mol. Its IUPAC name is tert-butyl-[(E,3S)-2-[(6S)-2-hydroxy-5,6-dihydrooxaborinin-6-yl]-2-methylhex-4-en-3-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(E,3S)-2-[(6S)-2-hydroxy-5,6-dihydrooxaborinin-6-yl]-2-methylhex-4-en-3-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 134938742 |
| Molecular Formula | C17H33BO3Si |
| Molecular Weight | 324.35 g/mol |
| Exact Mass | 324.23 |
| IUPAC Name | tert-butyl-[(E,3S)-2-[(6S)-2-hydroxy-5,6-dihydrooxaborinin-6-yl]-2-methylhex-4-en-3-yl]oxy-dimethylsilane |
| SMILES | C/C=C/[C@H](O[Si](C)(C)C(C)(C)C)C(C)(C)[C@@H]1CC=CB(O)O1 |
| InChI | InChI=1S/C17H33BO3Si/c1-9-11-15(21-22(7,8)16(2,3)4)17(5,6)14-12-10-13-18(19)20-14/h9-11,13-15,19H,12H2,1-8H3/b11-9+/t14-,15-/m0/s1 |
| InChIKey | CZFYNMADTCZWNF-WWUQSUGHSA-N |
| XLogP | 4.34 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.35 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|