C19H41IO2Si2 — CID 134938743
tert-butyl-[(1S,3S)-5-iodo-2,2-dimethyl-1-[(E)-prop-1-enyl]-3-trimethylsilyloxypentoxy]-dimethylsilane (PubChem CID 134938743) has the molecular formula C19H41IO2Si2 and a molecular weight of 484.61 g/mol. Its IUPAC name is tert-butyl-[(1S,3S)-5-iodo-2,2-dimethyl-1-[(E)-prop-1-enyl]-3-trimethylsilyloxypentoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(1S,3S)-5-iodo-2,2-dimethyl-1-[(E)-prop-1-enyl]-3-trimethylsilyloxypentoxy]-dimethylsilane |
|---|---|
| PubChem CID | 134938743 |
| Molecular Formula | C19H41IO2Si2 |
| Molecular Weight | 484.61 g/mol |
| Exact Mass | 484.17 |
| IUPAC Name | tert-butyl-[(1S,3S)-5-iodo-2,2-dimethyl-1-[(E)-prop-1-enyl]-3-trimethylsilyloxypentoxy]-dimethylsilane |
| SMILES | C/C=C/[C@H](O[Si](C)(C)C(C)(C)C)C(C)(C)[C@H](CCI)O[Si](C)(C)C |
| InChI | InChI=1S/C19H41IO2Si2/c1-12-13-16(22-24(10,11)18(2,3)4)19(5,6)17(14-15-20)21-23(7,8)9/h12-13,16-17H,14-15H2,1-11H3/b13-12+/t16-,17-/m0/s1 |
| InChIKey | BJGKHNOQYHNBPF-CPQFKCLQSA-N |
| XLogP | 7.02 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.61 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|