C23H27NO5 — CID 134938806
diethyl (4aS,9aS)-9-acetyl-1,3,4,4a,9a,10-hexahydrocyclopenta[b]carbazole-2,2-dicarboxylate (PubChem CID 134938806) has the molecular formula C23H27NO5 and a molecular weight of 397.47 g/mol. Its IUPAC name is diethyl (4aS,9aS)-9-acetyl-1,3,4,4a,9a,10-hexahydrocyclopenta[b]carbazole-2,2-dicarboxylate.
| Compound Name | diethyl (4aS,9aS)-9-acetyl-1,3,4,4a,9a,10-hexahydrocyclopenta[b]carbazole-2,2-dicarboxylate |
|---|---|
| PubChem CID | 134938806 |
| Molecular Formula | C23H27NO5 |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | diethyl (4aS,9aS)-9-acetyl-1,3,4,4a,9a,10-hexahydrocyclopenta[b]carbazole-2,2-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)CC2=C(C[C@H]3[C@@H](C2)c2ccccc2N3C(C)=O)C1 |
| InChI | InChI=1S/C23H27NO5/c1-4-28-21(26)23(22(27)29-5-2)12-15-10-18-17-8-6-7-9-19(17)24(14(3)25)20(18)11-16(15)13-23/h6-9,18,20H,4-5,10-13H2,1-3H3/t18-,20-/m0/s1 |
| InChIKey | FEXVSWATJVKSOZ-ICSRJNTNSA-N |
| XLogP | 3.50 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|