C29H28N2O2 — CID 134938872
methyl (E,2S,3R)-2-(benzhydrylideneamino)-4-methyl-5-phenyl-3-(prop-2-enylideneamino)pent-4-enoate (PubChem CID 134938872) has the molecular formula C29H28N2O2 and a molecular weight of 436.56 g/mol. Its IUPAC name is methyl (E,2S,3R)-2-(benzhydrylideneamino)-4-methyl-5-phenyl-3-(prop-2-enylideneamino)pent-4-enoate.
| Compound Name | methyl (E,2S,3R)-2-(benzhydrylideneamino)-4-methyl-5-phenyl-3-(prop-2-enylideneamino)pent-4-enoate |
|---|---|
| PubChem CID | 134938872 |
| Molecular Formula | C29H28N2O2 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | methyl (E,2S,3R)-2-(benzhydrylideneamino)-4-methyl-5-phenyl-3-(prop-2-enylideneamino)pent-4-enoate |
| SMILES | C=C/C=N/[C@H](/C(C)=C/c1ccccc1)[C@H](N=C(c1ccccc1)c1ccccc1)C(=O)OC |
| InChI | InChI=1S/C29H28N2O2/c1-4-20-30-26(22(2)21-23-14-8-5-9-15-23)28(29(32)33-3)31-27(24-16-10-6-11-17-24)25-18-12-7-13-19-25/h4-21,26,28H,1H2,2-3H3/b22-21+,30-20+/t26-,28+/m1/s1 |
| InChIKey | BSONWSYVEWOWQS-RSADDYDISA-N |
| XLogP | 5.79 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|