About (4S)-N-tert-butyl-5-methyl-7-propan-2-ylbicyclo[2.2.2]octa-2,5-diene-2-carboxamide
(4S)-N-tert-butyl-5-methyl-7-propan-2-ylbicyclo[2.2.2]octa-2,5-diene-2-carboxamide (PubChem CID 134938911) has the molecular formula C17H27NO
and a molecular weight of 261.41 g/mol. Its IUPAC name is (4S)-N-tert-butyl-5-methyl-7-propan-2-ylbicyclo[2.2.2]octa-2,5-diene-2-carboxamide.
Molecular Properties
| Compound Name | (4S)-N-tert-butyl-5-methyl-7-propan-2-ylbicyclo[2.2.2]octa-2,5-diene-2-carboxamide |
| PubChem CID | 134938911 |
| Molecular Formula | C17H27NO |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.21 |
| IUPAC Name | (4S)-N-tert-butyl-5-methyl-7-propan-2-ylbicyclo[2.2.2]octa-2,5-diene-2-carboxamide |
| SMILES | CC1=CC2C(C(=O)NC(C)(C)C)=C[C@@H]1CC2C(C)C |
| InChI | InChI=1S/C17H27NO/c1-10(2)13-8-12-9-15(14(13)7-11(12)3)16(19)18-17(4,5)6/h7,9-10,12-14H,8H2,1-6H3,(H,18,19)/t12-,13?,14?/m0/s1 |
| InChIKey | PQNZZZWUUQDRHL-HSBZDZAISA-N |
| XLogP | 3.70 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4S)-N-tert-butyl-5-methyl-7-propan-2-ylbicyclo[2.2.2]octa-2,5-diene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-N-tert-butyl-5-methyl-7-propan-2-ylbicyclo[2.2.2]octa-2,5-diene-2-carboxamide?
The IUPAC name of (4S)-N-tert-butyl-5-methyl-7-propan-2-ylbicyclo[2.2.2]octa-2,5-diene-2-carboxamide (CID 134938911) is (4S)-N-tert-butyl-5-methyl-7-propan-2-ylbicyclo[2.2.2]octa-2,5-diene-2-carboxamide.
What is the SMILES notation for (4S)-N-tert-butyl-5-methyl-7-propan-2-ylbicyclo[2.2.2]octa-2,5-diene-2-carboxamide?
The canonical SMILES for (4S)-N-tert-butyl-5-methyl-7-propan-2-ylbicyclo[2.2.2]octa-2,5-diene-2-carboxamide is CC1=CC2C(C(=O)NC(C)(C)C)=C[C@@H]1CC2C(C)C.
What is the InChIKey of (4S)-N-tert-butyl-5-methyl-7-propan-2-ylbicyclo[2.2.2]octa-2,5-diene-2-carboxamide?
The InChIKey is PQNZZZWUUQDRHL-HSBZDZAISA-N. The full InChI is InChI=1S/C17H27NO/c1-10(2)13-8-12-9-15(14(13)7-11(12)3)16(19)18-17(4,5)6/h7,9-10,12-14H,8H2,1-6H3,(H,18,19)/t12-,13?,14?/m0/s1.
What are the key properties of (4S)-N-tert-butyl-5-methyl-7-propan-2-ylbicyclo[2.2.2]octa-2,5-diene-2-carboxamide?
(4S)-N-tert-butyl-5-methyl-7-propan-2-ylbicyclo[2.2.2]octa-2,5-diene-2-carboxamide has a molecular weight of 261.41 g/mol, XLogP of 3.70, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-N-tert-butyl-5-methyl-7-propan-2-ylbicyclo[2.2.2]octa-2,5-diene-2-carboxamide is sourced from PubChem (CID 134938911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).