C20H28Br2O4 — CID 134938989
ethyl (2E,4E,6R)-6-[(3R)-6-bromo-8-(bromomethyl)-1,4-dimethyl-2,9-dioxabicyclo[3.3.1]non-7-en-3-yl]-4-methylhepta-2,4-dienoate (PubChem CID 134938989) has the molecular formula C20H28Br2O4 and a molecular weight of 492.25 g/mol. Its IUPAC name is ethyl (2E,4E,6R)-6-[(3R)-6-bromo-8-(bromomethyl)-1,4-dimethyl-2,9-dioxabicyclo[3.3.1]non-7-en-3-yl]-4-methylhepta-2,4-dienoate.
| Compound Name | ethyl (2E,4E,6R)-6-[(3R)-6-bromo-8-(bromomethyl)-1,4-dimethyl-2,9-dioxabicyclo[3.3.1]non-7-en-3-yl]-4-methylhepta-2,4-dienoate |
|---|---|
| PubChem CID | 134938989 |
| Molecular Formula | C20H28Br2O4 |
| Molecular Weight | 492.25 g/mol |
| Exact Mass | 490.04 |
| IUPAC Name | ethyl (2E,4E,6R)-6-[(3R)-6-bromo-8-(bromomethyl)-1,4-dimethyl-2,9-dioxabicyclo[3.3.1]non-7-en-3-yl]-4-methylhepta-2,4-dienoate |
| SMILES | CCOC(=O)/C=C/C(C)=C/[C@@H](C)[C@H]1OC2(C)OC(C(Br)C=C2CBr)C1C |
| InChI | InChI=1S/C20H28Br2O4/c1-6-24-17(23)8-7-12(2)9-13(3)18-14(4)19-16(22)10-15(11-21)20(5,25-18)26-19/h7-10,13-14,16,18-19H,6,11H2,1-5H3/b8-7+,12-9+/t13-,14?,16?,18-,19?,20?/m1/s1 |
| InChIKey | LLHSBTWRCSYHMO-IARGMJFBSA-N |
| XLogP | 4.92 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.25 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|