C22H31BrO6 — CID 134938990
ethyl (2E,4E,6R)-6-[(3R)-8-(acetyloxymethyl)-6-bromo-1,4-dimethyl-2,9-dioxabicyclo[3.3.1]non-7-en-3-yl]-4-methylhepta-2,4-dienoate (PubChem CID 134938990) has the molecular formula C22H31BrO6 and a molecular weight of 471.39 g/mol. Its IUPAC name is ethyl (2E,4E,6R)-6-[(3R)-8-(acetyloxymethyl)-6-bromo-1,4-dimethyl-2,9-dioxabicyclo[3.3.1]non-7-en-3-yl]-4-methylhepta-2,4-dienoate.
| Compound Name | ethyl (2E,4E,6R)-6-[(3R)-8-(acetyloxymethyl)-6-bromo-1,4-dimethyl-2,9-dioxabicyclo[3.3.1]non-7-en-3-yl]-4-methylhepta-2,4-dienoate |
|---|---|
| PubChem CID | 134938990 |
| Molecular Formula | C22H31BrO6 |
| Molecular Weight | 471.39 g/mol |
| Exact Mass | 470.13 |
| IUPAC Name | ethyl (2E,4E,6R)-6-[(3R)-8-(acetyloxymethyl)-6-bromo-1,4-dimethyl-2,9-dioxabicyclo[3.3.1]non-7-en-3-yl]-4-methylhepta-2,4-dienoate |
| SMILES | CCOC(=O)/C=C/C(C)=C/[C@@H](C)[C@H]1OC2(C)OC(C(Br)C=C2COC(C)=O)C1C |
| InChI | InChI=1S/C22H31BrO6/c1-7-26-19(25)9-8-13(2)10-14(3)20-15(4)21-18(23)11-17(12-27-16(5)24)22(6,28-20)29-21/h8-11,14-15,18,20-21H,7,12H2,1-6H3/b9-8+,13-10+/t14-,15?,18?,20-,21?,22?/m1/s1 |
| InChIKey | JUYAKEYGLUFBGZ-AABZPZJHSA-N |
| XLogP | 4.09 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.39 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|