C20H28O5 — CID 134938991
ethyl (2E,4E,6R)-6-[(3R,5S,8R)-1,4-dimethylspiro[2,9-dioxabicyclo[3.3.1]non-6-ene-8,2'-oxirane]-3-yl]-4-methylhepta-2,4-dienoate (PubChem CID 134938991) has the molecular formula C20H28O5 and a molecular weight of 348.44 g/mol. Its IUPAC name is ethyl (2E,4E,6R)-6-[(3R,5S,8R)-1,4-dimethylspiro[2,9-dioxabicyclo[3.3.1]non-6-ene-8,2'-oxirane]-3-yl]-4-methylhepta-2,4-dienoate.
| Compound Name | ethyl (2E,4E,6R)-6-[(3R,5S,8R)-1,4-dimethylspiro[2,9-dioxabicyclo[3.3.1]non-6-ene-8,2'-oxirane]-3-yl]-4-methylhepta-2,4-dienoate |
|---|---|
| PubChem CID | 134938991 |
| Molecular Formula | C20H28O5 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | ethyl (2E,4E,6R)-6-[(3R,5S,8R)-1,4-dimethylspiro[2,9-dioxabicyclo[3.3.1]non-6-ene-8,2'-oxirane]-3-yl]-4-methylhepta-2,4-dienoate |
| SMILES | CCOC(=O)/C=C/C(C)=C/[C@@H](C)[C@H]1OC2(C)O[C@@H](C=C[C@@]23CO3)C1C |
| InChI | InChI=1S/C20H28O5/c1-6-22-17(21)8-7-13(2)11-14(3)18-15(4)16-9-10-20(12-23-20)19(5,24-16)25-18/h7-11,14-16,18H,6,12H2,1-5H3/b8-7+,13-11+/t14-,15?,16+,18-,19?,20-/m1/s1 |
| InChIKey | DNJKWQFENWWNGN-ZYVFCPBVSA-N |
| XLogP | 3.16 |
| TPSA | 57.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|