C22H38O4Si — CID 134939171
(2S,3R,6Z,9R)-3-[tert-butyl(dimethyl)silyl]oxy-9-[(1Z)-2-methoxy-3-methylbuta-1,3-dienyl]-7-methyl-2,3,4,5,8,9-hexahydrooxonine-2-carbaldehyde (PubChem CID 134939171) has the molecular formula C22H38O4Si and a molecular weight of 394.63 g/mol. Its IUPAC name is (2S,3R,6Z,9R)-3-[tert-butyl(dimethyl)silyl]oxy-9-[(1Z)-2-methoxy-3-methylbuta-1,3-dienyl]-7-methyl-2,3,4,5,8,9-hexahydrooxonine-2-carbaldehyde.
| Compound Name | (2S,3R,6Z,9R)-3-[tert-butyl(dimethyl)silyl]oxy-9-[(1Z)-2-methoxy-3-methylbuta-1,3-dienyl]-7-methyl-2,3,4,5,8,9-hexahydrooxonine-2-carbaldehyde |
|---|---|
| PubChem CID | 134939171 |
| Molecular Formula | C22H38O4Si |
| Molecular Weight | 394.63 g/mol |
| Exact Mass | 394.25 |
| IUPAC Name | (2S,3R,6Z,9R)-3-[tert-butyl(dimethyl)silyl]oxy-9-[(1Z)-2-methoxy-3-methylbuta-1,3-dienyl]-7-methyl-2,3,4,5,8,9-hexahydrooxonine-2-carbaldehyde |
| SMILES | C=C(C)/C(=C/[C@H]1C/C(C)=C\CC[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C=O)O1)OC |
| InChI | InChI=1S/C22H38O4Si/c1-16(2)20(24-7)14-18-13-17(3)11-10-12-19(21(15-23)25-18)26-27(8,9)22(4,5)6/h11,14-15,18-19,21H,1,10,12-13H2,2-9H3/b17-11-,20-14-/t18-,19-,21-/m1/s1 |
| InChIKey | BVJNPRZPPFHJNT-JZYRCBRCSA-N |
| XLogP | 5.57 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.63 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|