C28H50O3Si2 — CID 134939202
(3aS,4R,5R,6aR)-5-[tert-butyl(dimethyl)silyl]oxy-4-[(E,3R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-methylhept-1-en-5-ynyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one (PubChem CID 134939202) has the molecular formula C28H50O3Si2 and a molecular weight of 490.88 g/mol. Its IUPAC name is (3aS,4R,5R,6aR)-5-[tert-butyl(dimethyl)silyl]oxy-4-[(E,3R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-methylhept-1-en-5-ynyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one.
| Compound Name | (3aS,4R,5R,6aR)-5-[tert-butyl(dimethyl)silyl]oxy-4-[(E,3R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-methylhept-1-en-5-ynyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one |
|---|---|
| PubChem CID | 134939202 |
| Molecular Formula | C28H50O3Si2 |
| Molecular Weight | 490.88 g/mol |
| Exact Mass | 490.33 |
| IUPAC Name | (3aS,4R,5R,6aR)-5-[tert-butyl(dimethyl)silyl]oxy-4-[(E,3R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-methylhept-1-en-5-ynyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one |
| SMILES | CC#C[C@H](C)[C@@H](/C=C/[C@@H]1[C@H]2CC(=O)C[C@H]2C[C@H]1O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H50O3Si2/c1-13-14-20(2)25(30-32(9,10)27(3,4)5)16-15-23-24-19-22(29)17-21(24)18-26(23)31-33(11,12)28(6,7)8/h15-16,20-21,23-26H,17-19H2,1-12H3/b16-15+/t20-,21-,23+,24-,25+,26+/m0/s1 |
| InChIKey | PFKIHEXQZRNZBS-OUKRDADZSA-N |
| XLogP | 7.60 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.88 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|