C22H31NO7 — CID 134939216
5-O-tert-butyl 4-O-methyl (2S,3aR,4S,6aS)-2-(3-phenylmethoxypropyl)-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-4,5-dicarboxylate (PubChem CID 134939216) has the molecular formula C22H31NO7 and a molecular weight of 421.49 g/mol. Its IUPAC name is 5-O-tert-butyl 4-O-methyl (2S,3aR,4S,6aS)-2-(3-phenylmethoxypropyl)-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-4,5-dicarboxylate.
| Compound Name | 5-O-tert-butyl 4-O-methyl (2S,3aR,4S,6aS)-2-(3-phenylmethoxypropyl)-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 134939216 |
| Molecular Formula | C22H31NO7 |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.21 |
| IUPAC Name | 5-O-tert-butyl 4-O-methyl (2S,3aR,4S,6aS)-2-(3-phenylmethoxypropyl)-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-4,5-dicarboxylate |
| SMILES | COC(=O)[C@@H]1[C@H]2O[C@@H](CCCOCc3ccccc3)O[C@H]2CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H31NO7/c1-22(2,3)30-21(25)23-13-16-19(18(23)20(24)26-4)29-17(28-16)11-8-12-27-14-15-9-6-5-7-10-15/h5-7,9-10,16-19H,8,11-14H2,1-4H3/t16-,17-,18-,19-/m0/s1 |
| InChIKey | DPBFCLOUBHZBLP-VJANTYMQSA-N |
| XLogP | 2.89 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|