C9H19NO2 — CID 134939493
(2S,3R)-3-hydroxy-N,N,2-trimethylhexanamide (PubChem CID 134939493) has the molecular formula C9H19NO2 and a molecular weight of 173.26 g/mol. Its IUPAC name is (2S,3R)-3-hydroxy-N,N,2-trimethylhexanamide.
| Compound Name | (2S,3R)-3-hydroxy-N,N,2-trimethylhexanamide |
|---|---|
| PubChem CID | 134939493 |
| Molecular Formula | C9H19NO2 |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.14 |
| IUPAC Name | (2S,3R)-3-hydroxy-N,N,2-trimethylhexanamide |
| SMILES | CCC[C@@H](O)[C@H](C)C(=O)N(C)C |
| InChI | InChI=1S/C9H19NO2/c1-5-6-8(11)7(2)9(12)10(3)4/h7-8,11H,5-6H2,1-4H3/t7-,8+/m0/s1 |
| InChIKey | DAQTXWHSBNJVQX-JGVFFNPUSA-N |
| XLogP | 0.87 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |