C6H2F12O — CID 13493957
1,1,1,2,2,4,5,5,5-nonafluoro-4-(trifluoromethyl)pentan-3-ol (PubChem CID 13493957) has the molecular formula C6H2F12O and a molecular weight of 318.06 g/mol. Its IUPAC name is 1,1,1,2,2,4,5,5,5-nonafluoro-4-(trifluoromethyl)pentan-3-ol.
| Compound Name | 1,1,1,2,2,4,5,5,5-nonafluoro-4-(trifluoromethyl)pentan-3-ol |
|---|---|
| PubChem CID | 13493957 |
| Molecular Formula | C6H2F12O |
| Molecular Weight | 318.06 g/mol |
| Exact Mass | 317.99 |
| IUPAC Name | 1,1,1,2,2,4,5,5,5-nonafluoro-4-(trifluoromethyl)pentan-3-ol |
| SMILES | OC(C(F)(F)C(F)(F)F)C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C6H2F12O/c7-2(4(10,11)12,5(13,14)15)1(19)3(8,9)6(16,17)18/h1,19H |
| InChIKey | RJAAOJXJEXSAQB-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.06 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|