C20H28O3 — CID 134939640
(3E,7E,10S,11R)-2-hydroxy-4,8-dimethyl-12-propan-2-ylidene-16-oxatricyclo[8.4.2.01,11]hexadeca-3,7-dien-15-one (PubChem CID 134939640) has the molecular formula C20H28O3 and a molecular weight of 316.44 g/mol. Its IUPAC name is (3E,7E,10S,11R)-2-hydroxy-4,8-dimethyl-12-propan-2-ylidene-16-oxatricyclo[8.4.2.01,11]hexadeca-3,7-dien-15-one.
| Compound Name | (3E,7E,10S,11R)-2-hydroxy-4,8-dimethyl-12-propan-2-ylidene-16-oxatricyclo[8.4.2.01,11]hexadeca-3,7-dien-15-one |
|---|---|
| PubChem CID | 134939640 |
| Molecular Formula | C20H28O3 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | (3E,7E,10S,11R)-2-hydroxy-4,8-dimethyl-12-propan-2-ylidene-16-oxatricyclo[8.4.2.01,11]hexadeca-3,7-dien-15-one |
| SMILES | CC(C)=C1CCC23C(=O)O[C@@H](C/C(C)=C/CC/C(C)=C/C2O)[C@H]13 |
| InChI | InChI=1S/C20H28O3/c1-12(2)15-8-9-20-17(21)11-14(4)7-5-6-13(3)10-16(18(15)20)23-19(20)22/h6,11,16-18,21H,5,7-10H2,1-4H3/b13-6+,14-11+/t16-,17?,18-,20?/m0/s1 |
| InChIKey | MNTITRCODCJEND-AQZHRTRESA-N |
| XLogP | 4.08 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|