About tris(2,2-dimethylpropyl)borane
tris(2,2-dimethylpropyl)borane (PubChem CID 13493981) has the molecular formula C15H33B
and a molecular weight of 224.24 g/mol. Its IUPAC name is tris(2,2-dimethylpropyl)borane.
Molecular Properties
| Compound Name | tris(2,2-dimethylpropyl)borane |
| PubChem CID | 13493981 |
| Molecular Formula | C15H33B |
| Molecular Weight | 224.24 g/mol |
| Exact Mass | 224.27 |
| IUPAC Name | tris(2,2-dimethylpropyl)borane |
| SMILES | CC(C)(C)CB(CC(C)(C)C)CC(C)(C)C |
| InChI | InChI=1S/C15H33B/c1-13(2,3)10-16(11-14(4,5)6)12-15(7,8)9/h10-12H2,1-9H3 |
| InChIKey | JKWHVCRIWKFKPZ-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 224.24 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tris(2,2-dimethylpropyl)borane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tris(2,2-dimethylpropyl)borane?
The IUPAC name of tris(2,2-dimethylpropyl)borane (CID 13493981) is tris(2,2-dimethylpropyl)borane.
What is the SMILES notation for tris(2,2-dimethylpropyl)borane?
The canonical SMILES for tris(2,2-dimethylpropyl)borane is CC(C)(C)CB(CC(C)(C)C)CC(C)(C)C.
What is the InChIKey of tris(2,2-dimethylpropyl)borane?
The InChIKey is JKWHVCRIWKFKPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H33B/c1-13(2,3)10-16(11-14(4,5)6)12-15(7,8)9/h10-12H2,1-9H3.
What are the key properties of tris(2,2-dimethylpropyl)borane?
tris(2,2-dimethylpropyl)borane has a molecular weight of 224.24 g/mol, XLogP of 5.62, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tris(2,2-dimethylpropyl)borane is sourced from PubChem (CID 13493981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).