C30H42N4O2SSi2 — CID 134939911
6,7-bis[2-tri(propan-2-yl)silylethynyl]-[1,2,5]thiadiazolo[3,4-g]quinoxaline-4,9-dione (PubChem CID 134939911) has the molecular formula C30H42N4O2SSi2 and a molecular weight of 578.93 g/mol. Its IUPAC name is 6,7-bis[2-tri(propan-2-yl)silylethynyl]-[1,2,5]thiadiazolo[3,4-g]quinoxaline-4,9-dione.
| Compound Name | 6,7-bis[2-tri(propan-2-yl)silylethynyl]-[1,2,5]thiadiazolo[3,4-g]quinoxaline-4,9-dione |
|---|---|
| PubChem CID | 134939911 |
| Molecular Formula | C30H42N4O2SSi2 |
| Molecular Weight | 578.93 g/mol |
| Exact Mass | 578.26 |
| IUPAC Name | 6,7-bis[2-tri(propan-2-yl)silylethynyl]-[1,2,5]thiadiazolo[3,4-g]quinoxaline-4,9-dione |
| SMILES | CC(C)[Si](C#Cc1nc2c(nc1C#C[Si](C(C)C)(C(C)C)C(C)C)C(=O)c1nsnc1C2=O)(C(C)C)C(C)C |
| InChI | InChI=1S/C30H42N4O2SSi2/c1-17(2)38(18(3)4,19(5)6)15-13-23-24(14-16-39(20(7)8,21(9)10)22(11)12)32-26-25(31-23)29(35)27-28(30(26)36)34-37-33-27/h17-22H,1-12H3 |
| InChIKey | FUXUJIRIJYYNSA-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 85.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.93 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|