C10H10CuF12O4 — CID 134939954
copper bis(1,1,1,5,5,5-hexafluoropentane-2,4-diol) (PubChem CID 134939954) has the molecular formula C10H10CuF12O4 and a molecular weight of 485.71 g/mol. Its IUPAC name is copper bis(1,1,1,5,5,5-hexafluoropentane-2,4-diol).
| Compound Name | copper bis(1,1,1,5,5,5-hexafluoropentane-2,4-diol) |
|---|---|
| PubChem CID | 134939954 |
| Molecular Formula | C10H10CuF12O4 |
| Molecular Weight | 485.71 g/mol |
| Exact Mass | 484.97 |
| IUPAC Name | copper bis(1,1,1,5,5,5-hexafluoropentane-2,4-diol) |
| SMILES | OC([CH-]C(O)C(F)(F)F)C(F)(F)F.OC([CH-]C(O)C(F)(F)F)C(F)(F)F.[Cu+2] |
| InChI | InChI=1S/2C5H5F6O2.Cu/c2*6-4(7,8)2(12)1-3(13)5(9,10)11;/h2*1-3,12-13H;/q2*-1;+2 |
| InChIKey | FQYUOLWRXFZLLT-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.71 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|