C23H16F13NO6S — CID 134939976
2-[2-[1,3-dioxo-6-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)benzo[de]isoquinolin-2-yl]ethoxy]ethyl methanesulfonate (PubChem CID 134939976) has the molecular formula C23H16F13NO6S and a molecular weight of 681.42 g/mol. Its IUPAC name is 2-[2-[1,3-dioxo-6-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)benzo[de]isoquinolin-2-yl]ethoxy]ethyl methanesulfonate.
| Compound Name | 2-[2-[1,3-dioxo-6-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)benzo[de]isoquinolin-2-yl]ethoxy]ethyl methanesulfonate |
|---|---|
| PubChem CID | 134939976 |
| Molecular Formula | C23H16F13NO6S |
| Molecular Weight | 681.42 g/mol |
| Exact Mass | 681.05 |
| IUPAC Name | 2-[2-[1,3-dioxo-6-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)benzo[de]isoquinolin-2-yl]ethoxy]ethyl methanesulfonate |
| SMILES | CS(=O)(=O)OCCOCCN1C(=O)c2cccc3c(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)ccc(c23)C1=O |
| InChI | InChI=1S/C23H16F13NO6S/c1-44(40,41)43-10-9-42-8-7-37-16(38)12-4-2-3-11-14(6-5-13(15(11)12)17(37)39)18(24,25)19(26,27)20(28,29)21(30,31)22(32,33)23(34,35)36/h2-6H,7-10H2,1H3 |
| InChIKey | HGGRCTQDTZTKOH-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.42 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|