C18H32O5 — CID 134940034
(1R)-1-[(2S)-2-[(2S)-2-hydroxyhept-6-enyl]-8-methyl-1,6-dioxaspiro[4.5]decan-7-yl]ethane-1,2-diol (PubChem CID 134940034) has the molecular formula C18H32O5 and a molecular weight of 328.45 g/mol. Its IUPAC name is (1R)-1-[(2S)-2-[(2S)-2-hydroxyhept-6-enyl]-8-methyl-1,6-dioxaspiro[4.5]decan-7-yl]ethane-1,2-diol.
| Compound Name | (1R)-1-[(2S)-2-[(2S)-2-hydroxyhept-6-enyl]-8-methyl-1,6-dioxaspiro[4.5]decan-7-yl]ethane-1,2-diol |
|---|---|
| PubChem CID | 134940034 |
| Molecular Formula | C18H32O5 |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | (1R)-1-[(2S)-2-[(2S)-2-hydroxyhept-6-enyl]-8-methyl-1,6-dioxaspiro[4.5]decan-7-yl]ethane-1,2-diol |
| SMILES | C=CCCC[C@H](O)C[C@@H]1CCC2(CCC(C)C([C@H](O)CO)O2)O1 |
| InChI | InChI=1S/C18H32O5/c1-3-4-5-6-14(20)11-15-8-10-18(22-15)9-7-13(2)17(23-18)16(21)12-19/h3,13-17,19-21H,1,4-12H2,2H3/t13?,14-,15-,16+,17?,18?/m0/s1 |
| InChIKey | JJQAEHCICGBCHN-PJTNKTBMSA-N |
| XLogP | 2.14 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|