About 5-pyridin-2-yl-1,3,4-oxathiazol-2-one
5-pyridin-2-yl-1,3,4-oxathiazol-2-one (PubChem CID 13494006) has the molecular formula C7H4N2O2S
and a molecular weight of 180.19 g/mol. Its IUPAC name is 5-pyridin-2-yl-1,3,4-oxathiazol-2-one.
Molecular Properties
| Compound Name | 5-pyridin-2-yl-1,3,4-oxathiazol-2-one |
| PubChem CID | 13494006 |
| Molecular Formula | C7H4N2O2S |
| Molecular Weight | 180.19 g/mol |
| Exact Mass | 180.00 |
| IUPAC Name | 5-pyridin-2-yl-1,3,4-oxathiazol-2-one |
| SMILES | O=c1oc(-c2ccccn2)ns1 |
| InChI | InChI=1S/C7H4N2O2S/c10-7-11-6(9-12-7)5-3-1-2-4-8-5/h1-4H |
| InChIKey | SOQSNWYFTJVMAF-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.19 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-pyridin-2-yl-1,3,4-oxathiazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-pyridin-2-yl-1,3,4-oxathiazol-2-one?
The IUPAC name of 5-pyridin-2-yl-1,3,4-oxathiazol-2-one (CID 13494006) is 5-pyridin-2-yl-1,3,4-oxathiazol-2-one.
What is the SMILES notation for 5-pyridin-2-yl-1,3,4-oxathiazol-2-one?
The canonical SMILES for 5-pyridin-2-yl-1,3,4-oxathiazol-2-one is O=c1oc(-c2ccccn2)ns1.
What is the InChIKey of 5-pyridin-2-yl-1,3,4-oxathiazol-2-one?
The InChIKey is SOQSNWYFTJVMAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4N2O2S/c10-7-11-6(9-12-7)5-3-1-2-4-8-5/h1-4H.
What are the key properties of 5-pyridin-2-yl-1,3,4-oxathiazol-2-one?
5-pyridin-2-yl-1,3,4-oxathiazol-2-one has a molecular weight of 180.19 g/mol, XLogP of 1.16, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-pyridin-2-yl-1,3,4-oxathiazol-2-one is sourced from PubChem (CID 13494006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).