C12H22O4S — CID 134940065
ethyl 6-[(2S,3R,4S)-3,4-dihydroxythiolan-2-yl]hexanoate (PubChem CID 134940065) has the molecular formula C12H22O4S and a molecular weight of 262.37 g/mol. Its IUPAC name is ethyl 6-[(2S,3R,4S)-3,4-dihydroxythiolan-2-yl]hexanoate.
| Compound Name | ethyl 6-[(2S,3R,4S)-3,4-dihydroxythiolan-2-yl]hexanoate |
|---|---|
| PubChem CID | 134940065 |
| Molecular Formula | C12H22O4S |
| Molecular Weight | 262.37 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | ethyl 6-[(2S,3R,4S)-3,4-dihydroxythiolan-2-yl]hexanoate |
| SMILES | CCOC(=O)CCCCC[C@@H]1SC[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C12H22O4S/c1-2-16-11(14)7-5-3-4-6-10-12(15)9(13)8-17-10/h9-10,12-13,15H,2-8H2,1H3/t9-,10+,12-/m1/s1 |
| InChIKey | AYTYPBOPBQWPGX-JFGNBEQYSA-N |
| XLogP | 1.34 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.37 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|