C40H80O4Si2 — CID 134940134
(2E,4R,6S,7S,8E,10S,11R,12S)-1,11-bis[[tert-butyl(dimethyl)silyl]oxy]-7-hydroxy-2,4,6,8,10,12-hexamethyldocosa-2,8-dien-5-one (PubChem CID 134940134) has the molecular formula C40H80O4Si2 and a molecular weight of 681.25 g/mol. Its IUPAC name is (2E,4R,6S,7S,8E,10S,11R,12S)-1,11-bis[[tert-butyl(dimethyl)silyl]oxy]-7-hydroxy-2,4,6,8,10,12-hexamethyldocosa-2,8-dien-5-one.
| Compound Name | (2E,4R,6S,7S,8E,10S,11R,12S)-1,11-bis[[tert-butyl(dimethyl)silyl]oxy]-7-hydroxy-2,4,6,8,10,12-hexamethyldocosa-2,8-dien-5-one |
|---|---|
| PubChem CID | 134940134 |
| Molecular Formula | C40H80O4Si2 |
| Molecular Weight | 681.25 g/mol |
| Exact Mass | 680.56 |
| IUPAC Name | (2E,4R,6S,7S,8E,10S,11R,12S)-1,11-bis[[tert-butyl(dimethyl)silyl]oxy]-7-hydroxy-2,4,6,8,10,12-hexamethyldocosa-2,8-dien-5-one |
| SMILES | CCCCCCCCCC[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)/C=C(\C)[C@@H](O)[C@H](C)C(=O)[C@H](C)/C=C(\C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C40H80O4Si2/c1-18-19-20-21-22-23-24-25-26-31(3)38(44-46(16,17)40(11,12)13)34(6)28-33(5)37(42)35(7)36(41)32(4)27-30(2)29-43-45(14,15)39(8,9)10/h27-28,31-32,34-35,37-38,42H,18-26,29H2,1-17H3/b30-27+,33-28+/t31-,32+,34-,35+,37+,38+/m0/s1 |
| InChIKey | HIVPEBFYGMZPQL-LMWUQVRCSA-N |
| XLogP | 12.30 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.25 |
| LogP ≤ 5 | 12.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|