C20H33NO5Si — CID 134940190
8-O-tert-butyl 2-O-methyl 3-[tert-butyl(dimethyl)silyl]oxy-8-azabicyclo[3.2.1]octa-2,6-diene-2,8-dicarboxylate (PubChem CID 134940190) has the molecular formula C20H33NO5Si and a molecular weight of 395.57 g/mol. Its IUPAC name is 8-O-tert-butyl 2-O-methyl 3-[tert-butyl(dimethyl)silyl]oxy-8-azabicyclo[3.2.1]octa-2,6-diene-2,8-dicarboxylate.
| Compound Name | 8-O-tert-butyl 2-O-methyl 3-[tert-butyl(dimethyl)silyl]oxy-8-azabicyclo[3.2.1]octa-2,6-diene-2,8-dicarboxylate |
|---|---|
| PubChem CID | 134940190 |
| Molecular Formula | C20H33NO5Si |
| Molecular Weight | 395.57 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | 8-O-tert-butyl 2-O-methyl 3-[tert-butyl(dimethyl)silyl]oxy-8-azabicyclo[3.2.1]octa-2,6-diene-2,8-dicarboxylate |
| SMILES | COC(=O)C1=C(O[Si](C)(C)C(C)(C)C)CC2C=CC1N2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H33NO5Si/c1-19(2,3)25-18(23)21-13-10-11-14(21)16(17(22)24-7)15(12-13)26-27(8,9)20(4,5)6/h10-11,13-14H,12H2,1-9H3 |
| InChIKey | SVQPQEZGCNMVBL-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.57 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|