C13H28Si — CID 134940286
trimethyl-[(E,3S)-5-methylnon-4-en-3-yl]silane (PubChem CID 134940286) has the molecular formula C13H28Si and a molecular weight of 212.45 g/mol. Its IUPAC name is trimethyl-[(E,3S)-5-methylnon-4-en-3-yl]silane.
| Compound Name | trimethyl-[(E,3S)-5-methylnon-4-en-3-yl]silane |
|---|---|
| PubChem CID | 134940286 |
| Molecular Formula | C13H28Si |
| Molecular Weight | 212.45 g/mol |
| Exact Mass | 212.20 |
| IUPAC Name | trimethyl-[(E,3S)-5-methylnon-4-en-3-yl]silane |
| SMILES | CCCC/C(C)=C/[C@H](CC)[Si](C)(C)C |
| InChI | InChI=1S/C13H28Si/c1-7-9-10-12(3)11-13(8-2)14(4,5)6/h11,13H,7-10H2,1-6H3/b12-11+/t13-/m0/s1 |
| InChIKey | RSNPZXOVWCPIFC-YLSINNKHSA-N |
| XLogP | 5.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.45 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|