C20H23NO2 — CID 134940344
tert-butyl (2R)-4-methylidene-2-naphthalen-2-ylpyrrolidine-1-carboxylate (PubChem CID 134940344) has the molecular formula C20H23NO2 and a molecular weight of 309.41 g/mol. Its IUPAC name is tert-butyl (2R)-4-methylidene-2-naphthalen-2-ylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R)-4-methylidene-2-naphthalen-2-ylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 134940344 |
| Molecular Formula | C20H23NO2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | tert-butyl (2R)-4-methylidene-2-naphthalen-2-ylpyrrolidine-1-carboxylate |
| SMILES | C=C1C[C@H](c2ccc3ccccc3c2)N(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C20H23NO2/c1-14-11-18(21(13-14)19(22)23-20(2,3)4)17-10-9-15-7-5-6-8-16(15)12-17/h5-10,12,18H,1,11,13H2,2-4H3/t18-/m1/s1 |
| InChIKey | GDGUNFSFGLDEKR-GOSISDBHSA-N |
| XLogP | 5.08 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|