C17H23NO5 — CID 134940618
1-[(3aR,4S,6aR)-4-(hydroxymethyl)-2,2-dimethyl-6-phenylmethoxy-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]oxazol-3-yl]ethanone (PubChem CID 134940618) has the molecular formula C17H23NO5 and a molecular weight of 321.37 g/mol. Its IUPAC name is 1-[(3aR,4S,6aR)-4-(hydroxymethyl)-2,2-dimethyl-6-phenylmethoxy-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]oxazol-3-yl]ethanone.
| Compound Name | 1-[(3aR,4S,6aR)-4-(hydroxymethyl)-2,2-dimethyl-6-phenylmethoxy-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]oxazol-3-yl]ethanone |
|---|---|
| PubChem CID | 134940618 |
| Molecular Formula | C17H23NO5 |
| Molecular Weight | 321.37 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | 1-[(3aR,4S,6aR)-4-(hydroxymethyl)-2,2-dimethyl-6-phenylmethoxy-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]oxazol-3-yl]ethanone |
| SMILES | CC(=O)N1[C@@H]2[C@@H](CO)OC(OCc3ccccc3)[C@@H]2OC1(C)C |
| InChI | InChI=1S/C17H23NO5/c1-11(20)18-14-13(9-19)22-16(15(14)23-17(18,2)3)21-10-12-7-5-4-6-8-12/h4-8,13-16,19H,9-10H2,1-3H3/t13-,14-,15-,16?/m1/s1 |
| InChIKey | VPVZUFIDBUIVMJ-SLCRAUQTSA-N |
| XLogP | 1.27 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.37 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |