C25H38NO9P — CID 134940619
ethyl 3-[(3aR,4R,6aR)-3-acetyl-2,2-dimethyl-6-phenylmethoxy-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]oxazol-4-yl]-2-diethoxyphosphorylpropanoate (PubChem CID 134940619) has the molecular formula C25H38NO9P and a molecular weight of 527.55 g/mol. Its IUPAC name is ethyl 3-[(3aR,4R,6aR)-3-acetyl-2,2-dimethyl-6-phenylmethoxy-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]oxazol-4-yl]-2-diethoxyphosphorylpropanoate.
| Compound Name | ethyl 3-[(3aR,4R,6aR)-3-acetyl-2,2-dimethyl-6-phenylmethoxy-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]oxazol-4-yl]-2-diethoxyphosphorylpropanoate |
|---|---|
| PubChem CID | 134940619 |
| Molecular Formula | C25H38NO9P |
| Molecular Weight | 527.55 g/mol |
| Exact Mass | 527.23 |
| IUPAC Name | ethyl 3-[(3aR,4R,6aR)-3-acetyl-2,2-dimethyl-6-phenylmethoxy-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]oxazol-4-yl]-2-diethoxyphosphorylpropanoate |
| SMILES | CCOC(=O)C(C[C@H]1OC(OCc2ccccc2)[C@@H]2OC(C)(C)N(C(C)=O)[C@H]12)P(=O)(OCC)OCC |
| InChI | InChI=1S/C25H38NO9P/c1-7-30-23(28)20(36(29,32-8-2)33-9-3)15-19-21-22(35-25(5,6)26(21)17(4)27)24(34-19)31-16-18-13-11-10-12-14-18/h10-14,19-22,24H,7-9,15-16H2,1-6H3/t19-,20?,21-,22-,24?/m1/s1 |
| InChIKey | ATXRZEFXXKWBOI-NKDKCSAOSA-N |
| XLogP | 3.87 |
| TPSA | 109.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.55 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|