About lithium;sodium;(1E)-1-ethoxy-2-methylbuta-1,3-diene-1,3-diolate
lithium;sodium;(1E)-1-ethoxy-2-methylbuta-1,3-diene-1,3-diolate (PubChem CID 134940654) has the molecular formula C7H10LiNaO3
and a molecular weight of 172.08 g/mol. Its IUPAC name is lithium;sodium;(1E)-1-ethoxy-2-methylbuta-1,3-diene-1,3-diolate.
Molecular Properties
| Compound Name | lithium;sodium;(1E)-1-ethoxy-2-methylbuta-1,3-diene-1,3-diolate |
| PubChem CID | 134940654 |
| Molecular Formula | C7H10LiNaO3 |
| Molecular Weight | 172.08 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | lithium;sodium;(1E)-1-ethoxy-2-methylbuta-1,3-diene-1,3-diolate |
| SMILES | C=C([O-])/C(C)=C(\[O-])OCC.[Li+].[Na+] |
| InChI | InChI=1S/C7H12O3.Li.Na/c1-4-10-7(9)5(2)6(3)8;;/h8-9H,3-4H2,1-2H3;;/q;2*+1/p-2/b7-5+;; |
| InChIKey | SBUQZSJHDDKMCU-WVKUUHRJSA-L |
| XLogP | -6.50 |
| TPSA | 55.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.08 |
| LogP ≤ 5 | -6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze lithium;sodium;(1E)-1-ethoxy-2-methylbuta-1,3-diene-1,3-diolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;sodium;(1E)-1-ethoxy-2-methylbuta-1,3-diene-1,3-diolate?
The IUPAC name of lithium;sodium;(1E)-1-ethoxy-2-methylbuta-1,3-diene-1,3-diolate (CID 134940654) is lithium;sodium;(1E)-1-ethoxy-2-methylbuta-1,3-diene-1,3-diolate.
What is the SMILES notation for lithium;sodium;(1E)-1-ethoxy-2-methylbuta-1,3-diene-1,3-diolate?
The canonical SMILES for lithium;sodium;(1E)-1-ethoxy-2-methylbuta-1,3-diene-1,3-diolate is C=C([O-])/C(C)=C(\[O-])OCC.[Li+].[Na+].
What is the InChIKey of lithium;sodium;(1E)-1-ethoxy-2-methylbuta-1,3-diene-1,3-diolate?
The InChIKey is SBUQZSJHDDKMCU-WVKUUHRJSA-L. The full InChI is InChI=1S/C7H12O3.Li.Na/c1-4-10-7(9)5(2)6(3)8;;/h8-9H,3-4H2,1-2H3;;/q;2*+1/p-2/b7-5+;;.
What are the key properties of lithium;sodium;(1E)-1-ethoxy-2-methylbuta-1,3-diene-1,3-diolate?
lithium;sodium;(1E)-1-ethoxy-2-methylbuta-1,3-diene-1,3-diolate has a molecular weight of 172.08 g/mol, XLogP of -6.50, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;sodium;(1E)-1-ethoxy-2-methylbuta-1,3-diene-1,3-diolate is sourced from PubChem (CID 134940654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).