About methyl 2-[(1S)-1-[[(R)-tert-butylsulfinyl]amino]but-3-enyl]-3,5-dimethoxybenzoate
methyl 2-[(1S)-1-[[(R)-tert-butylsulfinyl]amino]but-3-enyl]-3,5-dimethoxybenzoate (PubChem CID 134940719) has the molecular formula C18H27NO5S
and a molecular weight of 369.48 g/mol. Its IUPAC name is methyl 2-[(1S)-1-[[(R)-tert-butylsulfinyl]amino]but-3-enyl]-3,5-dimethoxybenzoate.
Molecular Properties
| Compound Name | methyl 2-[(1S)-1-[[(R)-tert-butylsulfinyl]amino]but-3-enyl]-3,5-dimethoxybenzoate |
| PubChem CID | 134940719 |
| Molecular Formula | C18H27NO5S |
| Molecular Weight | 369.48 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | methyl 2-[(1S)-1-[[(R)-tert-butylsulfinyl]amino]but-3-enyl]-3,5-dimethoxybenzoate |
| SMILES | C=CC[C@H](N[S@](=O)C(C)(C)C)c1c(OC)cc(OC)cc1C(=O)OC |
| InChI | InChI=1S/C18H27NO5S/c1-8-9-14(19-25(21)18(2,3)4)16-13(17(20)24-7)10-12(22-5)11-15(16)23-6/h8,10-11,14,19H,1,9H2,2-7H3/t14-,25+/m0/s1 |
| InChIKey | PINLFHWAGGPYGS-HWRSSNJWSA-N |
| XLogP | 3.16 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.48 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[(1S)-1-[[(R)-tert-butylsulfinyl]amino]but-3-enyl]-3,5-dimethoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(1S)-1-[[(R)-tert-butylsulfinyl]amino]but-3-enyl]-3,5-dimethoxybenzoate?
The IUPAC name of methyl 2-[(1S)-1-[[(R)-tert-butylsulfinyl]amino]but-3-enyl]-3,5-dimethoxybenzoate (CID 134940719) is methyl 2-[(1S)-1-[[(R)-tert-butylsulfinyl]amino]but-3-enyl]-3,5-dimethoxybenzoate.
What is the SMILES notation for methyl 2-[(1S)-1-[[(R)-tert-butylsulfinyl]amino]but-3-enyl]-3,5-dimethoxybenzoate?
The canonical SMILES for methyl 2-[(1S)-1-[[(R)-tert-butylsulfinyl]amino]but-3-enyl]-3,5-dimethoxybenzoate is C=CC[C@H](N[S@](=O)C(C)(C)C)c1c(OC)cc(OC)cc1C(=O)OC.
What is the InChIKey of methyl 2-[(1S)-1-[[(R)-tert-butylsulfinyl]amino]but-3-enyl]-3,5-dimethoxybenzoate?
The InChIKey is PINLFHWAGGPYGS-HWRSSNJWSA-N. The full InChI is InChI=1S/C18H27NO5S/c1-8-9-14(19-25(21)18(2,3)4)16-13(17(20)24-7)10-12(22-5)11-15(16)23-6/h8,10-11,14,19H,1,9H2,2-7H3/t14-,25+/m0/s1.
What are the key properties of methyl 2-[(1S)-1-[[(R)-tert-butylsulfinyl]amino]but-3-enyl]-3,5-dimethoxybenzoate?
methyl 2-[(1S)-1-[[(R)-tert-butylsulfinyl]amino]but-3-enyl]-3,5-dimethoxybenzoate has a molecular weight of 369.48 g/mol, XLogP of 3.16, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(1S)-1-[[(R)-tert-butylsulfinyl]amino]but-3-enyl]-3,5-dimethoxybenzoate is sourced from PubChem (CID 134940719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).