C23H45LiO4Si2 — CID 134940723
lithium [(4aR,8R,8aR)-2,2-ditert-butyl-4a,6,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3,2]dioxasilin-6-id-8-yl]oxy-tri(propan-2-yl)silane (PubChem CID 134940723) has the molecular formula C23H45LiO4Si2 and a molecular weight of 448.72 g/mol. Its IUPAC name is lithium [(4aR,8R,8aR)-2,2-ditert-butyl-4a,6,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3,2]dioxasilin-6-id-8-yl]oxy-tri(propan-2-yl)silane.
| Compound Name | lithium [(4aR,8R,8aR)-2,2-ditert-butyl-4a,6,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3,2]dioxasilin-6-id-8-yl]oxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 134940723 |
| Molecular Formula | C23H45LiO4Si2 |
| Molecular Weight | 448.72 g/mol |
| Exact Mass | 448.30 |
| IUPAC Name | lithium [(4aR,8R,8aR)-2,2-ditert-butyl-4a,6,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3,2]dioxasilin-6-id-8-yl]oxy-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](O[C@@H]1C=[C-]O[C@@H]2CO[Si](C(C)(C)C)(C(C)(C)C)O[C@@H]12)(C(C)C)C(C)C.[Li+] |
| InChI | InChI=1S/C23H45O4Si2.Li/c1-16(2)28(17(3)4,18(5)6)26-19-13-14-24-20-15-25-29(22(7,8)9,23(10,11)12)27-21(19)20;/h13,16-21H,15H2,1-12H3;/q-1;+1/t19-,20-,21+;/m1./s1 |
| InChIKey | BQJHIZOHDAXINK-ODYJERINSA-N |
| XLogP | 3.72 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.72 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|