C18H23IO3 — CID 134940730
(4R)-7-[(1E,3E,5Z)-6-iodo-2,4-dimethylhepta-1,3,5-trienyl]-4,6,7-trimethyl-2-oxabicyclo[2.2.1]heptane-3,5-dione (PubChem CID 134940730) has the molecular formula C18H23IO3 and a molecular weight of 414.28 g/mol. Its IUPAC name is (4R)-7-[(1E,3E,5Z)-6-iodo-2,4-dimethylhepta-1,3,5-trienyl]-4,6,7-trimethyl-2-oxabicyclo[2.2.1]heptane-3,5-dione.
| Compound Name | (4R)-7-[(1E,3E,5Z)-6-iodo-2,4-dimethylhepta-1,3,5-trienyl]-4,6,7-trimethyl-2-oxabicyclo[2.2.1]heptane-3,5-dione |
|---|---|
| PubChem CID | 134940730 |
| Molecular Formula | C18H23IO3 |
| Molecular Weight | 414.28 g/mol |
| Exact Mass | 414.07 |
| IUPAC Name | (4R)-7-[(1E,3E,5Z)-6-iodo-2,4-dimethylhepta-1,3,5-trienyl]-4,6,7-trimethyl-2-oxabicyclo[2.2.1]heptane-3,5-dione |
| SMILES | C/C(I)=C/C(C)=C/C(C)=C/C1(C)C2OC(=O)[C@@]1(C)C(=O)C2C |
| InChI | InChI=1S/C18H23IO3/c1-10(8-12(3)19)7-11(2)9-17(5)15-13(4)14(20)18(17,6)16(21)22-15/h7-9,13,15H,1-6H3/b10-7+,11-9+,12-8-/t13?,15?,17?,18-/m1/s1 |
| InChIKey | JELVMMAKQDCNTJ-YBRJDNBISA-N |
| XLogP | 4.37 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.28 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|