C13H17BrO3 — CID 134940731
(4R)-7-[(E)-3-bromo-2-methylprop-1-enyl]-4,6,7-trimethyl-2-oxabicyclo[2.2.1]heptane-3,5-dione (PubChem CID 134940731) has the molecular formula C13H17BrO3 and a molecular weight of 301.18 g/mol. Its IUPAC name is (4R)-7-[(E)-3-bromo-2-methylprop-1-enyl]-4,6,7-trimethyl-2-oxabicyclo[2.2.1]heptane-3,5-dione.
| Compound Name | (4R)-7-[(E)-3-bromo-2-methylprop-1-enyl]-4,6,7-trimethyl-2-oxabicyclo[2.2.1]heptane-3,5-dione |
|---|---|
| PubChem CID | 134940731 |
| Molecular Formula | C13H17BrO3 |
| Molecular Weight | 301.18 g/mol |
| Exact Mass | 300.04 |
| IUPAC Name | (4R)-7-[(E)-3-bromo-2-methylprop-1-enyl]-4,6,7-trimethyl-2-oxabicyclo[2.2.1]heptane-3,5-dione |
| SMILES | C/C(=C\C1(C)C2OC(=O)[C@@]1(C)C(=O)C2C)CBr |
| InChI | InChI=1S/C13H17BrO3/c1-7(6-14)5-12(3)10-8(2)9(15)13(12,4)11(16)17-10/h5,8,10H,6H2,1-4H3/b7-5+/t8?,10?,12?,13-/m1/s1 |
| InChIKey | ATYRVFFPDHUMNT-UKAHHALOSA-N |
| XLogP | 2.48 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.18 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|