About (1R,2S)-2-[diphenylphosphoryl-[(1S)-1-phenylethyl]amino]-1,2-diphenylethanol
(1R,2S)-2-[diphenylphosphoryl-[(1S)-1-phenylethyl]amino]-1,2-diphenylethanol (PubChem CID 134940746) has the molecular formula C34H32NO2P
and a molecular weight of 517.61 g/mol. Its IUPAC name is (1R,2S)-2-[diphenylphosphoryl-[(1S)-1-phenylethyl]amino]-1,2-diphenylethanol.
Molecular Properties
| Compound Name | (1R,2S)-2-[diphenylphosphoryl-[(1S)-1-phenylethyl]amino]-1,2-diphenylethanol |
| PubChem CID | 134940746 |
| Molecular Formula | C34H32NO2P |
| Molecular Weight | 517.61 g/mol |
| Exact Mass | 517.22 |
| IUPAC Name | (1R,2S)-2-[diphenylphosphoryl-[(1S)-1-phenylethyl]amino]-1,2-diphenylethanol |
| SMILES | C[C@@H](c1ccccc1)N([C@@H](c1ccccc1)[C@H](O)c1ccccc1)P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H32NO2P/c1-27(28-17-7-2-8-18-28)35(38(37,31-23-13-5-14-24-31)32-25-15-6-16-26-32)33(29-19-9-3-10-20-29)34(36)30-21-11-4-12-22-30/h2-27,33-34,36H,1H3/t27-,33-,34+/m0/s1 |
| InChIKey | OOHCXMXTCDWXQF-FBBJSWSOSA-N |
| XLogP | 7.45 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 517.61 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (1R,2S)-2-[diphenylphosphoryl-[(1S)-1-phenylethyl]amino]-1,2-diphenylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,2S)-2-[diphenylphosphoryl-[(1S)-1-phenylethyl]amino]-1,2-diphenylethanol?
The IUPAC name of (1R,2S)-2-[diphenylphosphoryl-[(1S)-1-phenylethyl]amino]-1,2-diphenylethanol (CID 134940746) is (1R,2S)-2-[diphenylphosphoryl-[(1S)-1-phenylethyl]amino]-1,2-diphenylethanol.
What is the SMILES notation for (1R,2S)-2-[diphenylphosphoryl-[(1S)-1-phenylethyl]amino]-1,2-diphenylethanol?
The canonical SMILES for (1R,2S)-2-[diphenylphosphoryl-[(1S)-1-phenylethyl]amino]-1,2-diphenylethanol is C[C@@H](c1ccccc1)N([C@@H](c1ccccc1)[C@H](O)c1ccccc1)P(=O)(c1ccccc1)c1ccccc1.
What is the InChIKey of (1R,2S)-2-[diphenylphosphoryl-[(1S)-1-phenylethyl]amino]-1,2-diphenylethanol?
The InChIKey is OOHCXMXTCDWXQF-FBBJSWSOSA-N. The full InChI is InChI=1S/C34H32NO2P/c1-27(28-17-7-2-8-18-28)35(38(37,31-23-13-5-14-24-31)32-25-15-6-16-26-32)33(29-19-9-3-10-20-29)34(36)30-21-11-4-12-22-30/h2-27,33-34,36H,1H3/t27-,33-,34+/m0/s1.
What are the key properties of (1R,2S)-2-[diphenylphosphoryl-[(1S)-1-phenylethyl]amino]-1,2-diphenylethanol?
(1R,2S)-2-[diphenylphosphoryl-[(1S)-1-phenylethyl]amino]-1,2-diphenylethanol has a molecular weight of 517.61 g/mol, XLogP of 7.45, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,2S)-2-[diphenylphosphoryl-[(1S)-1-phenylethyl]amino]-1,2-diphenylethanol is sourced from PubChem (CID 134940746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).