C35H66O4Si2 — CID 134940747
tert-butyl-[[(2R,3S)-8-[(2E,4E,6S,7S)-6-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethylnona-2,4,8-trienyl]-3,9-dimethyl-1,7-dioxaspiro[5.5]undecan-2-yl]methoxy]-dimethylsilane (PubChem CID 134940747) has the molecular formula C35H66O4Si2 and a molecular weight of 607.08 g/mol. Its IUPAC name is tert-butyl-[[(2R,3S)-8-[(2E,4E,6S,7S)-6-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethylnona-2,4,8-trienyl]-3,9-dimethyl-1,7-dioxaspiro[5.5]undecan-2-yl]methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(2R,3S)-8-[(2E,4E,6S,7S)-6-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethylnona-2,4,8-trienyl]-3,9-dimethyl-1,7-dioxaspiro[5.5]undecan-2-yl]methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 134940747 |
| Molecular Formula | C35H66O4Si2 |
| Molecular Weight | 607.08 g/mol |
| Exact Mass | 606.45 |
| IUPAC Name | tert-butyl-[[(2R,3S)-8-[(2E,4E,6S,7S)-6-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethylnona-2,4,8-trienyl]-3,9-dimethyl-1,7-dioxaspiro[5.5]undecan-2-yl]methoxy]-dimethylsilane |
| SMILES | C=C[C@H](C)[C@H](/C=C/C(C)=C/CC1OC2(CCC1C)CC[C@H](C)[C@H](CO[Si](C)(C)C(C)(C)C)O2)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C35H66O4Si2/c1-16-27(3)31(39-41(14,15)34(9,10)11)20-18-26(2)17-19-30-28(4)21-23-35(37-30)24-22-29(5)32(38-35)25-36-40(12,13)33(6,7)8/h16-18,20,27-32H,1,19,21-25H2,2-15H3/b20-18+,26-17+/t27-,28?,29-,30?,31-,32-,35?/m0/s1 |
| InChIKey | VSTDGFSVOJLKAQ-PLXDARPBSA-N |
| XLogP | 10.44 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.08 |
| LogP ≤ 5 | 10.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|