C22H26N2O4S2 — CID 134940775
5-but-3-enyl-1,4-bis-(4-methylphenyl)sulfonyl-2,3-dihydropyrazine (PubChem CID 134940775) has the molecular formula C22H26N2O4S2 and a molecular weight of 446.59 g/mol. Its IUPAC name is 5-but-3-enyl-1,4-bis-(4-methylphenyl)sulfonyl-2,3-dihydropyrazine.
| Compound Name | 5-but-3-enyl-1,4-bis-(4-methylphenyl)sulfonyl-2,3-dihydropyrazine |
|---|---|
| PubChem CID | 134940775 |
| Molecular Formula | C22H26N2O4S2 |
| Molecular Weight | 446.59 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | 5-but-3-enyl-1,4-bis-(4-methylphenyl)sulfonyl-2,3-dihydropyrazine |
| SMILES | C=CCCC1=CN(S(=O)(=O)c2ccc(C)cc2)CCN1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C22H26N2O4S2/c1-4-5-6-20-17-23(29(25,26)21-11-7-18(2)8-12-21)15-16-24(20)30(27,28)22-13-9-19(3)10-14-22/h4,7-14,17H,1,5-6,15-16H2,2-3H3 |
| InChIKey | MZEOSDBHXACENO-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.59 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|