C25H48O4Si — CID 134940787
ethyl (2E,4R,5S,6R,7R,8S,10E)-7-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2,4,6,8,10-pentamethyldodeca-2,10-dienoate (PubChem CID 134940787) has the molecular formula C25H48O4Si and a molecular weight of 440.74 g/mol. Its IUPAC name is ethyl (2E,4R,5S,6R,7R,8S,10E)-7-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2,4,6,8,10-pentamethyldodeca-2,10-dienoate.
| Compound Name | ethyl (2E,4R,5S,6R,7R,8S,10E)-7-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2,4,6,8,10-pentamethyldodeca-2,10-dienoate |
|---|---|
| PubChem CID | 134940787 |
| Molecular Formula | C25H48O4Si |
| Molecular Weight | 440.74 g/mol |
| Exact Mass | 440.33 |
| IUPAC Name | ethyl (2E,4R,5S,6R,7R,8S,10E)-7-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2,4,6,8,10-pentamethyldodeca-2,10-dienoate |
| SMILES | C/C=C(\C)C[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)[C@@H](O)[C@H](C)/C=C(\C)C(=O)OCC |
| InChI | InChI=1S/C25H48O4Si/c1-13-17(3)15-19(5)23(29-30(11,12)25(8,9)10)21(7)22(26)18(4)16-20(6)24(27)28-14-2/h13,16,18-19,21-23,26H,14-15H2,1-12H3/b17-13+,20-16+/t18-,19+,21-,22+,23-/m1/s1 |
| InChIKey | YHRVPFKICMGGNX-HUWMDQSGSA-N |
| XLogP | 6.51 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.74 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|