C24H44O4Si — CID 134940816
(Z,4S,5R,6R,7R)-6-[tert-butyl(dimethyl)silyl]oxy-5,7-dimethyl-11-(oxan-2-yloxy)undec-9-en-1-yn-4-ol (PubChem CID 134940816) has the molecular formula C24H44O4Si and a molecular weight of 424.70 g/mol. Its IUPAC name is (Z,4S,5R,6R,7R)-6-[tert-butyl(dimethyl)silyl]oxy-5,7-dimethyl-11-(oxan-2-yloxy)undec-9-en-1-yn-4-ol.
| Compound Name | (Z,4S,5R,6R,7R)-6-[tert-butyl(dimethyl)silyl]oxy-5,7-dimethyl-11-(oxan-2-yloxy)undec-9-en-1-yn-4-ol |
|---|---|
| PubChem CID | 134940816 |
| Molecular Formula | C24H44O4Si |
| Molecular Weight | 424.70 g/mol |
| Exact Mass | 424.30 |
| IUPAC Name | (Z,4S,5R,6R,7R)-6-[tert-butyl(dimethyl)silyl]oxy-5,7-dimethyl-11-(oxan-2-yloxy)undec-9-en-1-yn-4-ol |
| SMILES | C#CC[C@H](O)[C@@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)C/C=C\COC1CCCCO1 |
| InChI | InChI=1S/C24H44O4Si/c1-9-14-21(25)20(3)23(28-29(7,8)24(4,5)6)19(2)15-10-12-17-26-22-16-11-13-18-27-22/h1,10,12,19-23,25H,11,13-18H2,2-8H3/b12-10-/t19-,20-,21+,22?,23-/m1/s1 |
| InChIKey | ZRCKRHGHUYNDPX-OCIAVTOQSA-N |
| XLogP | 5.52 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.70 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|