About (2S)-2-[diphenylphosphoryl(methyl)amino]-1,2-diphenylethanol
(2S)-2-[diphenylphosphoryl(methyl)amino]-1,2-diphenylethanol (PubChem CID 134940855) has the molecular formula C27H26NO2P
and a molecular weight of 427.48 g/mol. Its IUPAC name is (2S)-2-[diphenylphosphoryl(methyl)amino]-1,2-diphenylethanol.
Molecular Properties
| Compound Name | (2S)-2-[diphenylphosphoryl(methyl)amino]-1,2-diphenylethanol |
| PubChem CID | 134940855 |
| Molecular Formula | C27H26NO2P |
| Molecular Weight | 427.48 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | (2S)-2-[diphenylphosphoryl(methyl)amino]-1,2-diphenylethanol |
| SMILES | CN([C@@H](c1ccccc1)C(O)c1ccccc1)P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H26NO2P/c1-28(31(30,24-18-10-4-11-19-24)25-20-12-5-13-21-25)26(22-14-6-2-7-15-22)27(29)23-16-8-3-9-17-23/h2-21,26-27,29H,1H3/t26-,27?/m0/s1 |
| InChIKey | FJVKAIIHXOMLEO-QBHOUYDASA-N |
| XLogP | 5.32 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 427.48 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-[diphenylphosphoryl(methyl)amino]-1,2-diphenylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-[diphenylphosphoryl(methyl)amino]-1,2-diphenylethanol?
The IUPAC name of (2S)-2-[diphenylphosphoryl(methyl)amino]-1,2-diphenylethanol (CID 134940855) is (2S)-2-[diphenylphosphoryl(methyl)amino]-1,2-diphenylethanol.
What is the SMILES notation for (2S)-2-[diphenylphosphoryl(methyl)amino]-1,2-diphenylethanol?
The canonical SMILES for (2S)-2-[diphenylphosphoryl(methyl)amino]-1,2-diphenylethanol is CN([C@@H](c1ccccc1)C(O)c1ccccc1)P(=O)(c1ccccc1)c1ccccc1.
What is the InChIKey of (2S)-2-[diphenylphosphoryl(methyl)amino]-1,2-diphenylethanol?
The InChIKey is FJVKAIIHXOMLEO-QBHOUYDASA-N. The full InChI is InChI=1S/C27H26NO2P/c1-28(31(30,24-18-10-4-11-19-24)25-20-12-5-13-21-25)26(22-14-6-2-7-15-22)27(29)23-16-8-3-9-17-23/h2-21,26-27,29H,1H3/t26-,27?/m0/s1.
What are the key properties of (2S)-2-[diphenylphosphoryl(methyl)amino]-1,2-diphenylethanol?
(2S)-2-[diphenylphosphoryl(methyl)amino]-1,2-diphenylethanol has a molecular weight of 427.48 g/mol, XLogP of 5.32, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[diphenylphosphoryl(methyl)amino]-1,2-diphenylethanol is sourced from PubChem (CID 134940855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).