C18H24F3NO — CID 134940927
2,2,2-trifluoro-N-(3-methylbutyl)-N-[(3R)-5-phenylpent-1-en-3-yl]acetamide (PubChem CID 134940927) has the molecular formula C18H24F3NO and a molecular weight of 327.39 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-(3-methylbutyl)-N-[(3R)-5-phenylpent-1-en-3-yl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-(3-methylbutyl)-N-[(3R)-5-phenylpent-1-en-3-yl]acetamide |
|---|---|
| PubChem CID | 134940927 |
| Molecular Formula | C18H24F3NO |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | 2,2,2-trifluoro-N-(3-methylbutyl)-N-[(3R)-5-phenylpent-1-en-3-yl]acetamide |
| SMILES | C=C[C@@H](CCc1ccccc1)N(CCC(C)C)C(=O)C(F)(F)F |
| InChI | InChI=1S/C18H24F3NO/c1-4-16(11-10-15-8-6-5-7-9-15)22(13-12-14(2)3)17(23)18(19,20)21/h4-9,14,16H,1,10-13H2,2-3H3/t16-/m0/s1 |
| InChIKey | YTIQCUQZZOUCLD-INIZCTEOSA-N |
| XLogP | 4.61 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|