C36H69LiO5Si2 — CID 134940941
lithium triethyl-[[(4R,6R,8R,10S,13R)-13-methyl-10-(2-methylidenepentyl)-4-[2-tri(propan-2-yl)silyloxyethyl]-5,7,9-trioxadispiro[5.1.58.26]pentadecan-13-yl]oxy]silane (PubChem CID 134940941) has the molecular formula C36H69LiO5Si2 and a molecular weight of 645.06 g/mol. Its IUPAC name is lithium triethyl-[[(4R,6R,8R,10S,13R)-13-methyl-10-(2-methylidenepentyl)-4-[2-tri(propan-2-yl)silyloxyethyl]-5,7,9-trioxadispiro[5.1.58.26]pentadecan-13-yl]oxy]silane.
| Compound Name | lithium triethyl-[[(4R,6R,8R,10S,13R)-13-methyl-10-(2-methylidenepentyl)-4-[2-tri(propan-2-yl)silyloxyethyl]-5,7,9-trioxadispiro[5.1.58.26]pentadecan-13-yl]oxy]silane |
|---|---|
| PubChem CID | 134940941 |
| Molecular Formula | C36H69LiO5Si2 |
| Molecular Weight | 645.06 g/mol |
| Exact Mass | 644.48 |
| IUPAC Name | lithium triethyl-[[(4R,6R,8R,10S,13R)-13-methyl-10-(2-methylidenepentyl)-4-[2-tri(propan-2-yl)silyloxyethyl]-5,7,9-trioxadispiro[5.1.58.26]pentadecan-13-yl]oxy]silane |
| SMILES | C=C(CC[CH2-])C[C@@H]1CC[C@@](C)(O[Si](CC)(CC)CC)[C@]2(CC[C@@]3(CCC[C@H](CCO[Si](C(C)C)(C(C)C)C(C)C)O3)O2)O1.[Li+] |
| InChI | InChI=1S/C36H69O5Si2.Li/c1-13-18-31(11)27-33-20-23-34(12,41-42(14-2,15-3)16-4)36(39-33)25-24-35(40-36)22-17-19-32(38-35)21-26-37-43(28(5)6,29(7)8)30(9)10;/h28-30,32-33H,1,11,13-27H2,2-10,12H3;/q-1;+1/t32-,33+,34-,35-,36-;/m1./s1 |
| InChIKey | GVJRSQSHCLTDOZ-QTLIPDPSSA-N |
| XLogP | 7.86 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.06 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|