About chlorozinc(1+);trimethyl-[2-[[(E,7R)-tridec-5-en-7-yl]oxymethoxy]ethyl]silane
chlorozinc(1+);trimethyl-[2-[[(E,7R)-tridec-5-en-7-yl]oxymethoxy]ethyl]silane (PubChem CID 134941015) has the molecular formula C19H39ClO2SiZn
and a molecular weight of 428.45 g/mol. Its IUPAC name is chlorozinc(1+);trimethyl-[2-[[(E,7R)-tridec-5-en-7-yl]oxymethoxy]ethyl]silane.
Molecular Properties
| Compound Name | chlorozinc(1+);trimethyl-[2-[[(E,7R)-tridec-5-en-7-yl]oxymethoxy]ethyl]silane |
| PubChem CID | 134941015 |
| Molecular Formula | C19H39ClO2SiZn |
| Molecular Weight | 428.45 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | chlorozinc(1+);trimethyl-[2-[[(E,7R)-tridec-5-en-7-yl]oxymethoxy]ethyl]silane |
| SMILES | Cl[Zn+].[CH2-]CCC/C=C/[C@@H](CCCCCC)OCOCC[Si](C)(C)C |
| InChI | InChI=1S/C19H39O2Si.ClH.Zn/c1-6-8-10-12-14-19(15-13-11-9-7-2)21-18-20-16-17-22(3,4)5;;/h12,14,19H,1,6-11,13,15-18H2,2-5H3;1H;/q-1;;+2/p-1/b14-12+;;/t19-;;/m0../s1 |
| InChIKey | RUDHELAKDBJNBI-LRRISBDESA-M |
| XLogP | 6.90 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 428.45 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze chlorozinc(1+);trimethyl-[2-[[(E,7R)-tridec-5-en-7-yl]oxymethoxy]ethyl]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chlorozinc(1+);trimethyl-[2-[[(E,7R)-tridec-5-en-7-yl]oxymethoxy]ethyl]silane?
The IUPAC name of chlorozinc(1+);trimethyl-[2-[[(E,7R)-tridec-5-en-7-yl]oxymethoxy]ethyl]silane (CID 134941015) is chlorozinc(1+);trimethyl-[2-[[(E,7R)-tridec-5-en-7-yl]oxymethoxy]ethyl]silane.
What is the SMILES notation for chlorozinc(1+);trimethyl-[2-[[(E,7R)-tridec-5-en-7-yl]oxymethoxy]ethyl]silane?
The canonical SMILES for chlorozinc(1+);trimethyl-[2-[[(E,7R)-tridec-5-en-7-yl]oxymethoxy]ethyl]silane is Cl[Zn+].[CH2-]CCC/C=C/[C@@H](CCCCCC)OCOCC[Si](C)(C)C.
What is the InChIKey of chlorozinc(1+);trimethyl-[2-[[(E,7R)-tridec-5-en-7-yl]oxymethoxy]ethyl]silane?
The InChIKey is RUDHELAKDBJNBI-LRRISBDESA-M. The full InChI is InChI=1S/C19H39O2Si.ClH.Zn/c1-6-8-10-12-14-19(15-13-11-9-7-2)21-18-20-16-17-22(3,4)5;;/h12,14,19H,1,6-11,13,15-18H2,2-5H3;1H;/q-1;;+2/p-1/b14-12+;;/t19-;;/m0../s1.
What are the key properties of chlorozinc(1+);trimethyl-[2-[[(E,7R)-tridec-5-en-7-yl]oxymethoxy]ethyl]silane?
chlorozinc(1+);trimethyl-[2-[[(E,7R)-tridec-5-en-7-yl]oxymethoxy]ethyl]silane has a molecular weight of 428.45 g/mol, XLogP of 6.90, 15 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for chlorozinc(1+);trimethyl-[2-[[(E,7R)-tridec-5-en-7-yl]oxymethoxy]ethyl]silane is sourced from PubChem (CID 134941015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).