C18H23NO2S — CID 134941102
(S)-N-[(1S,2S)-1-(furan-2-yl)-2-phenylbut-3-enyl]-2-methylpropane-2-sulfinamide (PubChem CID 134941102) has the molecular formula C18H23NO2S and a molecular weight of 317.45 g/mol. Its IUPAC name is (S)-N-[(1S,2S)-1-(furan-2-yl)-2-phenylbut-3-enyl]-2-methylpropane-2-sulfinamide.
| Compound Name | (S)-N-[(1S,2S)-1-(furan-2-yl)-2-phenylbut-3-enyl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 134941102 |
| Molecular Formula | C18H23NO2S |
| Molecular Weight | 317.45 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | (S)-N-[(1S,2S)-1-(furan-2-yl)-2-phenylbut-3-enyl]-2-methylpropane-2-sulfinamide |
| SMILES | C=C[C@@H](c1ccccc1)[C@H](N[S@@](=O)C(C)(C)C)c1ccco1 |
| InChI | InChI=1S/C18H23NO2S/c1-5-15(14-10-7-6-8-11-14)17(16-12-9-13-21-16)19-22(20)18(2,3)4/h5-13,15,17,19H,1H2,2-4H3/t15-,17-,22-/m0/s1 |
| InChIKey | VLPCNRJPSMUSIB-YHEJKZAPSA-N |
| XLogP | 4.34 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.45 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|