C18H31NO4 — CID 134941198
tert-butyl (2R,4aS,5R,8aR)-2-(2-methoxy-2-oxoethyl)-5-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carboxylate (PubChem CID 134941198) has the molecular formula C18H31NO4 and a molecular weight of 325.45 g/mol. Its IUPAC name is tert-butyl (2R,4aS,5R,8aR)-2-(2-methoxy-2-oxoethyl)-5-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carboxylate.
| Compound Name | tert-butyl (2R,4aS,5R,8aR)-2-(2-methoxy-2-oxoethyl)-5-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carboxylate |
|---|---|
| PubChem CID | 134941198 |
| Molecular Formula | C18H31NO4 |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.23 |
| IUPAC Name | tert-butyl (2R,4aS,5R,8aR)-2-(2-methoxy-2-oxoethyl)-5-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carboxylate |
| SMILES | COC(=O)C[C@H]1CC[C@H]2[C@H](C)CCC[C@H]2N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H31NO4/c1-12-7-6-8-15-14(12)10-9-13(11-16(20)22-5)19(15)17(21)23-18(2,3)4/h12-15H,6-11H2,1-5H3/t12-,13-,14+,15-/m1/s1 |
| InChIKey | UWNLBLZQESHYFD-APIJFGDWSA-N |
| XLogP | 3.75 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |