C22H31NO4Si — CID 134941315
N-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-4-(3-hydroxypropoxy)benzamide (PubChem CID 134941315) has the molecular formula C22H31NO4Si and a molecular weight of 401.58 g/mol. Its IUPAC name is N-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-4-(3-hydroxypropoxy)benzamide.
| Compound Name | N-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-4-(3-hydroxypropoxy)benzamide |
|---|---|
| PubChem CID | 134941315 |
| Molecular Formula | C22H31NO4Si |
| Molecular Weight | 401.58 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | N-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-4-(3-hydroxypropoxy)benzamide |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc(NC(=O)c2ccc(OCCCO)cc2)cc1 |
| InChI | InChI=1S/C22H31NO4Si/c1-22(2,3)28(4,5)27-20-13-9-18(10-14-20)23-21(25)17-7-11-19(12-8-17)26-16-6-15-24/h7-14,24H,6,15-16H2,1-5H3,(H,23,25) |
| InChIKey | NDPRHUUFSFIHQQ-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.58 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|