About 1-bromoheptylcyclohexane
1-bromoheptylcyclohexane (PubChem CID 134941395) has the molecular formula C13H25Br
and a molecular weight of 261.25 g/mol. Its IUPAC name is 1-bromoheptylcyclohexane.
Molecular Properties
| Compound Name | 1-bromoheptylcyclohexane |
| PubChem CID | 134941395 |
| Molecular Formula | C13H25Br |
| Molecular Weight | 261.25 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | 1-bromoheptylcyclohexane |
| SMILES | CCCCCCC(Br)C1CCCCC1 |
| InChI | InChI=1S/C13H25Br/c1-2-3-4-8-11-13(14)12-9-6-5-7-10-12/h12-13H,2-11H2,1H3 |
| InChIKey | QQBBRQUZSSJBBN-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 261.25 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-bromoheptylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromoheptylcyclohexane?
The IUPAC name of 1-bromoheptylcyclohexane (CID 134941395) is 1-bromoheptylcyclohexane.
What is the SMILES notation for 1-bromoheptylcyclohexane?
The canonical SMILES for 1-bromoheptylcyclohexane is CCCCCCC(Br)C1CCCCC1.
What is the InChIKey of 1-bromoheptylcyclohexane?
The InChIKey is QQBBRQUZSSJBBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25Br/c1-2-3-4-8-11-13(14)12-9-6-5-7-10-12/h12-13H,2-11H2,1H3.
What are the key properties of 1-bromoheptylcyclohexane?
1-bromoheptylcyclohexane has a molecular weight of 261.25 g/mol, XLogP of 5.30, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromoheptylcyclohexane is sourced from PubChem (CID 134941395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).