About bis[(Z)-but-2-enyl]-[(4R,5R)-5-methyloct-6-yn-4-yl]oxysilane
bis[(Z)-but-2-enyl]-[(4R,5R)-5-methyloct-6-yn-4-yl]oxysilane (PubChem CID 134941584) has the molecular formula C17H30OSi
and a molecular weight of 278.51 g/mol. Its IUPAC name is bis[(Z)-but-2-enyl]-[(4R,5R)-5-methyloct-6-yn-4-yl]oxysilane.
Molecular Properties
| Compound Name | bis[(Z)-but-2-enyl]-[(4R,5R)-5-methyloct-6-yn-4-yl]oxysilane |
| PubChem CID | 134941584 |
| Molecular Formula | C17H30OSi |
| Molecular Weight | 278.51 g/mol |
| Exact Mass | 278.21 |
| IUPAC Name | bis[(Z)-but-2-enyl]-[(4R,5R)-5-methyloct-6-yn-4-yl]oxysilane |
| SMILES | CC#C[C@@H](C)[C@@H](CCC)O[SiH](C/C=C\C)C/C=C\C |
| InChI | InChI=1S/C17H30OSi/c1-6-10-14-19(15-11-7-2)18-17(13-9-4)16(5)12-8-3/h6-7,10-11,16-17,19H,9,13-15H2,1-5H3/b10-6-,11-7-/t16-,17-/m1/s1 |
| InChIKey | CQZFGBPICQBDIF-RDPVWHKQSA-N |
| XLogP | 4.71 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.51 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze bis[(Z)-but-2-enyl]-[(4R,5R)-5-methyloct-6-yn-4-yl]oxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[(Z)-but-2-enyl]-[(4R,5R)-5-methyloct-6-yn-4-yl]oxysilane?
The IUPAC name of bis[(Z)-but-2-enyl]-[(4R,5R)-5-methyloct-6-yn-4-yl]oxysilane (CID 134941584) is bis[(Z)-but-2-enyl]-[(4R,5R)-5-methyloct-6-yn-4-yl]oxysilane.
What is the SMILES notation for bis[(Z)-but-2-enyl]-[(4R,5R)-5-methyloct-6-yn-4-yl]oxysilane?
The canonical SMILES for bis[(Z)-but-2-enyl]-[(4R,5R)-5-methyloct-6-yn-4-yl]oxysilane is CC#C[C@@H](C)[C@@H](CCC)O[SiH](C/C=C\C)C/C=C\C.
What is the InChIKey of bis[(Z)-but-2-enyl]-[(4R,5R)-5-methyloct-6-yn-4-yl]oxysilane?
The InChIKey is CQZFGBPICQBDIF-RDPVWHKQSA-N. The full InChI is InChI=1S/C17H30OSi/c1-6-10-14-19(15-11-7-2)18-17(13-9-4)16(5)12-8-3/h6-7,10-11,16-17,19H,9,13-15H2,1-5H3/b10-6-,11-7-/t16-,17-/m1/s1.
What are the key properties of bis[(Z)-but-2-enyl]-[(4R,5R)-5-methyloct-6-yn-4-yl]oxysilane?
bis[(Z)-but-2-enyl]-[(4R,5R)-5-methyloct-6-yn-4-yl]oxysilane has a molecular weight of 278.51 g/mol, XLogP of 4.71, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for bis[(Z)-but-2-enyl]-[(4R,5R)-5-methyloct-6-yn-4-yl]oxysilane is sourced from PubChem (CID 134941584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).